CAS 103205-48-7 appears in our catalog under these names: Methyl 2-ethyl-5-nitrobenzoate, 95%, Methyl 2-ethyl-5-nitrobenzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 2-ethyl-5-nitrobenzoate (CAS 103205-48-7) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: methyl 2-ethyl-5-nitrobenzoate. InChIKey: QCBAWUWFMSIGNL-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | methyl 2-ethyl-5-nitrobenzoate |
| InChIKey | QCBAWUWFMSIGNL-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=C(C=C1)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)