CAS 1032114-81-0 appears in our catalog under these names: (S)-1-(2,4-Dimethylphenyl)propan-1-amine hydrochloride, 95%, (S)–1–(2,4–Dimethylphenyl)propan–1–amine hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(1S)-1-(2,4-dimethylphenyl)propan-1-amine;hydrochloride (CAS 1032114-81-0) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: (1S)-1-(2,4-dimethylphenyl)propan-1-amine;hydrochloride. InChIKey: IBRGHVMFMQNILO-MERQFXBCSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | (1S)-1-(2,4-dimethylphenyl)propan-1-amine;hydrochloride |
| InChIKey | IBRGHVMFMQNILO-MERQFXBCSA-N |
| SMILES | CC[C@@H](C1=C(C=C(C=C1)C)C)N.Cl |
Computed by PubChem (NCBI)