CAS 1268982-48-4 appears in our catalog under these names: [1-(2,4-Dimethylphenyl)propyl]amine hydrochloride, 95%, 1-(2,4-Dimethylphenyl)propan-1-amine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2,5g.
1-(2,4-dimethylphenyl)propan-1-amine;hydrochloride (CAS 1268982-48-4) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: 1-(2,4-dimethylphenyl)propan-1-amine;hydrochloride. InChIKey: IBRGHVMFMQNILO-UHFFFAOYSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | 1-(2,4-dimethylphenyl)propan-1-amine;hydrochloride |
| InChIKey | IBRGHVMFMQNILO-UHFFFAOYSA-N |
| SMILES | CCC(C1=C(C=C(C=C1)C)C)N.Cl |
Computed by PubChem (NCBI)