CAS 103274-40-4 is the registry number for 5-Amino-1-(3-methylphenyl)-1h-1,2,3-triazole-4-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
5-amino-1-(3-methylphenyl)triazole-4-carboxamide (CAS 103274-40-4) is a chemical compound with the molecular formula C10H11N5O and a molecular weight of 217.23 g/mol. IUPAC name: 5-amino-1-(3-methylphenyl)triazole-4-carboxamide. InChIKey: OZUFDNGGVGGVBY-UHFFFAOYSA-N.
| Molecular formula | C10H11N5O |
|---|---|
| Molecular weight | 217.23 g/mol |
| IUPAC name | 5-amino-1-(3-methylphenyl)triazole-4-carboxamide |
| InChIKey | OZUFDNGGVGGVBY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N2C(=C(N=N2)C(=O)N)N |
Computed by PubChem (NCBI)