CAS 81153-35-7 is the registry number for 1,6,8-Trimethyl-1,6-dihydrodipyrazolo[3,4-b:3',4'-d]pyridin-3(2H)-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3,10,12-trimethyl-3,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-5-one (CAS 81153-35-7) is a chemical compound with the molecular formula C10H11N5O and a molecular weight of 217.23 g/mol. IUPAC name: 3,10,12-trimethyl-3,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-5-one. InChIKey: LTSOCXDJBJXBAV-UHFFFAOYSA-N.
| Molecular formula | C10H11N5O |
|---|---|
| Molecular weight | 217.23 g/mol |
| IUPAC name | 3,10,12-trimethyl-3,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-5-one |
| InChIKey | LTSOCXDJBJXBAV-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=NC=C3C(=C12)N(NC3=O)C)C |
Computed by PubChem (NCBI)