CAS 1779132-22-7 is the registry number for 6-(Pyrrolidin-1-ylcarbonyl)[1,2,4]triazolo[4,3-a]pyrimidine, 90%. Offered by: Combi-blocks. Available pack sizes: 100mg.
Pyrrolidin-1-yl([1,2,4]triazolo[4,3-a]pyrimidin-6-yl)methanone (CAS 1779132-22-7) is a chemical compound with the molecular formula C10H11N5O and a molecular weight of 217.23 g/mol. IUPAC name: pyrrolidin-1-yl([1,2,4]triazolo[4,3-a]pyrimidin-6-yl)methanone. InChIKey: CKKKTMGZNZRZCB-UHFFFAOYSA-N.
| Molecular formula | C10H11N5O |
|---|---|
| Molecular weight | 217.23 g/mol |
| IUPAC name | pyrrolidin-1-yl([1,2,4]triazolo[4,3-a]pyrimidin-6-yl)methanone |
| InChIKey | CKKKTMGZNZRZCB-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)C2=CN3C=NN=C3N=C2 |
Computed by PubChem (NCBI)