CAS 30354-91-7 appears in our catalog under these names: 2,4-Diamino-6-(4-methoxyphenyl)-1,3,5-triazine, 98%, 6-(4-Methoxyphenyl)-1,3,5-triazine-2,4-diamine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 10g, 1g.
6-(4-methoxyphenyl)-1,3,5-triazine-2,4-diamine (CAS 30354-91-7) is a chemical compound with the molecular formula C10H11N5O and a molecular weight of 217.23 g/mol. IUPAC name: 6-(4-methoxyphenyl)-1,3,5-triazine-2,4-diamine. InChIKey: WBDWTNWLWBQFJU-UHFFFAOYSA-N.
| Molecular formula | C10H11N5O |
|---|---|
| Molecular weight | 217.23 g/mol |
| IUPAC name | 6-(4-methoxyphenyl)-1,3,5-triazine-2,4-diamine |
| InChIKey | WBDWTNWLWBQFJU-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NC(=NC(=N2)N)N |
Computed by PubChem (NCBI)