CAS 4342-08-9 appears in our catalog under these names: 5-Amino-1-benzyl-1h-1,2,3-triazole-4-carboxamide, 95%, Carboxyamidotriazole Impurity 4. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 5g, 250mg, 1g, on request.
5-amino-1-benzyltriazole-4-carboxamide (CAS 4342-08-9) is a chemical compound with the molecular formula C10H11N5O and a molecular weight of 217.23 g/mol. IUPAC name: 5-amino-1-benzyltriazole-4-carboxamide. InChIKey: SPSJTSUTONSWEX-UHFFFAOYSA-N.
| Molecular formula | C10H11N5O |
|---|---|
| Molecular weight | 217.23 g/mol |
| IUPAC name | 5-amino-1-benzyltriazole-4-carboxamide |
| InChIKey | SPSJTSUTONSWEX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=C(N=N2)C(=O)N)N |
Computed by PubChem (NCBI)