CAS 103361-42-8 appears in our catalog under these names: 6-Des-(4,5,6,7-Tetrahydro-1H-isoindole-1,3(2H)-dione) 6-Amino Flumioxazin, Flumioxazin (free amine), Flumioxazin (free amine) 100 µg/mL in Acetonitrile, 6-Amino-7-fluoro-4-(prop-2-yn-1-yl)-3,4-dihydro-2H-1,4-benzoxazin-3-one, Flumioxazin Metabolite APF, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, Dr. Ehrenstorfer, Biosynth, HPC Standards. Available pack sizes: 250mg, 10mg, 1ml, 0,5g, 50mg, 1x1ml, 1x10mg.
6-amino-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one (CAS 103361-42-8) is a chemical compound with the molecular formula C11H9FN2O2 and a molecular weight of 220.20 g/mol. IUPAC name: 6-amino-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one. InChIKey: VHRCRGJPHYNVGS-UHFFFAOYSA-N.
| Molecular formula | C11H9FN2O2 |
|---|---|
| Molecular weight | 220.20 g/mol |
| IUPAC name | 6-amino-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one |
| InChIKey | VHRCRGJPHYNVGS-UHFFFAOYSA-N |
| SMILES | C#CCN1C(=O)COC2=C1C=C(C(=C2)F)N |
Computed by PubChem (NCBI)