Products 1033720-13-6
CAS 1033720-13-6 appears in our catalog under these names: Methyl-1-naphthalenemethylamine-d3, Methyl-1-naphthalenemethylamine-D₃. Offered by: TRC. Available pack sizes: 10mg, 1mg, 5mg.
1,1,1-trideuterio-N-(naphthalen-1-ylmethyl)methanamine (CAS 1033720-13-6) is a chemical compound with the molecular formula C12H13N and a molecular weight of 174.26 g/mol. IUPAC name: 1,1,1-trideuterio-N-(naphthalen-1-ylmethyl)methanamine. InChIKey: MQRIUFVBEVFILS-FIBGUPNXSA-N.
| Molecular formula | C12H13N |
|---|---|
| Molecular weight | 174.26 g/mol |
| IUPAC name | 1,1,1-trideuterio-N-(naphthalen-1-ylmethyl)methanamine |
| InChIKey | MQRIUFVBEVFILS-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NCC1=CC=CC2=CC=CC=C21 |
Computed by PubChem (NCBI)