CAS 1189686-07-4 is the registry number for N-(1-Naphthyl-d7-methyl)methylamine. Offered by: TRC. Available pack sizes: 100mg, 10mg.
1-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-N-methylmethanamine (CAS 1189686-07-4) is a chemical compound with the molecular formula C12H13N and a molecular weight of 178.28 g/mol. IUPAC name: 1-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-N-methylmethanamine. InChIKey: MQRIUFVBEVFILS-CFWCETGYSA-N.
| Molecular formula | C12H13N |
|---|---|
| Molecular weight | 178.28 g/mol |
| IUPAC name | 1-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-N-methylmethanamine |
| InChIKey | MQRIUFVBEVFILS-CFWCETGYSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C(C(=C(C2=C1[2H])[2H])[2H])[2H])CNC)[2H])[2H] |
Computed by PubChem (NCBI)