Products 1035235-27-8
CAS 1035235-27-8 appears in our catalog under these names: N-Boc-4-bromoisoindoline, 97%, 97%, tert-Butyl 4-bromoisoindoline-2-carboxylate, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g.
Tert-butyl 4-bromo-1,3-dihydroisoindole-2-carboxylate (CAS 1035235-27-8) is a chemical compound with the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. IUPAC name: tert-butyl 4-bromo-1,3-dihydroisoindole-2-carboxylate. InChIKey: BFCZVUVSPUKWET-UHFFFAOYSA-N.
| Molecular formula | C13H16BrNO2 |
|---|---|
| Molecular weight | 298.18 g/mol |
| IUPAC name | tert-butyl 4-bromo-1,3-dihydroisoindole-2-carboxylate |
| InChIKey | BFCZVUVSPUKWET-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1)C(=CC=C2)Br |
Computed by PubChem (NCBI)