CAS 103565-48-6 is the registry number for Methoxamine Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-1-(2,5-dimethoxyphenyl)propan-1-one;hydrochloride (CAS 103565-48-6) is a chemical compound with the molecular formula C11H16ClNO3 and a molecular weight of 245.70 g/mol. IUPAC name: 2-amino-1-(2,5-dimethoxyphenyl)propan-1-one;hydrochloride. InChIKey: SNZUJCDRFAWDRT-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO3 |
|---|---|
| Molecular weight | 245.70 g/mol |
| IUPAC name | 2-amino-1-(2,5-dimethoxyphenyl)propan-1-one;hydrochloride |
| InChIKey | SNZUJCDRFAWDRT-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=C(C=CC(=C1)OC)OC)N.Cl |
Computed by PubChem (NCBI)