CAS 1035700-06-1 appears in our catalog under these names: Methyl 1,2,3,4-tetrahydroisoquinoline-5-carboxylate hydrochloride, 95%, Methyl 1,2,3,4-tetrahydroisoquinoline-5-carboxylate hydrochloride, methyl 1,2,3,4-tetrahydroisoquinoline-5-carboxylate hydrochloride, 97%, 97%, Methyl 1,2,3,4-tetrahydroisoquinoline-5-carboxylate hydrochloride, 96%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg, 500mg.
Methyl 1,2,3,4-tetrahydroisoquinoline-5-carboxylate;hydrochloride (CAS 1035700-06-1) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: methyl 1,2,3,4-tetrahydroisoquinoline-5-carboxylate;hydrochloride. InChIKey: DTFQONPAXHKIBB-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | methyl 1,2,3,4-tetrahydroisoquinoline-5-carboxylate;hydrochloride |
| InChIKey | DTFQONPAXHKIBB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC2=C1CCNC2.Cl |
Computed by PubChem (NCBI)