CAS 1035840-13-1 appears in our catalog under these names: [4-(5-Chloro-1,3-benzoxazol-2-yl)morpholin-2-yl]methylamine hydrochloride, 95%, (4-(5-Chlorobenzo(d)oxazol-2-yl)morpholin-2-yl)methanamine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
[4-(5-chloro-1,3-benzoxazol-2-yl)morpholin-2-yl]methanamine (CAS 1035840-13-1) is a chemical compound with the molecular formula C12H14ClN3O2 and a molecular weight of 267.71 g/mol. IUPAC name: [4-(5-chloro-1,3-benzoxazol-2-yl)morpholin-2-yl]methanamine. InChIKey: XWNXQWYCGICPDT-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN3O2 |
|---|---|
| Molecular weight | 267.71 g/mol |
| IUPAC name | [4-(5-chloro-1,3-benzoxazol-2-yl)morpholin-2-yl]methanamine |
| InChIKey | XWNXQWYCGICPDT-UHFFFAOYSA-N |
| SMILES | C1COC(CN1C2=NC3=C(O2)C=CC(=C3)Cl)CN |
Computed by PubChem (NCBI)