CAS 215530-63-5 appears in our catalog under these names: Ethyl 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-2-methylpropanoate, 95%, Ethyl 2–(6–chloroimidazo(1,2–b)pyridazin–2–yl)–2–methylpropanoate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Ethyl 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-2-methylpropanoate (CAS 215530-63-5) is a chemical compound with the molecular formula C12H14ClN3O2 and a molecular weight of 267.71 g/mol. IUPAC name: ethyl 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-2-methylpropanoate. InChIKey: JCRUBWCYIOZELU-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN3O2 |
|---|---|
| Molecular weight | 267.71 g/mol |
| IUPAC name | ethyl 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-2-methylpropanoate |
| InChIKey | JCRUBWCYIOZELU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C)C1=CN2C(=N1)C=CC(=N2)Cl |
Computed by PubChem (NCBI)