Products 658084-80-1
CAS 658084-80-1 appears in our catalog under these names: Ethyl 4-chloro-5-isopropylpyrrolo[2,1-f][1,2,4]triazine-6-carboxylate, 95%, Ethyl 4-chloro-5-isopropylpyrrolo(2,1-f)(1,2,4)triazine-6-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg, 5g, 10g.
Ethyl 4-chloro-5-propan-2-ylpyrrolo[2,1-f][1,2,4]triazine-6-carboxylate (CAS 658084-80-1) is a chemical compound with the molecular formula C12H14ClN3O2 and a molecular weight of 267.71 g/mol. IUPAC name: ethyl 4-chloro-5-propan-2-ylpyrrolo[2,1-f][1,2,4]triazine-6-carboxylate. InChIKey: KVAZOUBYLUYIFZ-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN3O2 |
|---|---|
| Molecular weight | 267.71 g/mol |
| IUPAC name | ethyl 4-chloro-5-propan-2-ylpyrrolo[2,1-f][1,2,4]triazine-6-carboxylate |
| InChIKey | KVAZOUBYLUYIFZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN2C(=C1C(C)C)C(=NC=N2)Cl |
Computed by PubChem (NCBI)