Products 1305325-11-4
CAS 1305325-11-4 is the registry number for tert-Butyl (5-chloro-1h-pyrrolo[2,3-b]pyridin-6-yl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl N-(5-chloro-1H-pyrrolo[2,3-b]pyridin-6-yl)carbamate (CAS 1305325-11-4) is a chemical compound with the molecular formula C12H14ClN3O2 and a molecular weight of 267.71 g/mol. IUPAC name: tert-butyl N-(5-chloro-1H-pyrrolo[2,3-b]pyridin-6-yl)carbamate. InChIKey: MESCCEJMHUSKCH-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN3O2 |
|---|---|
| Molecular weight | 267.71 g/mol |
| IUPAC name | tert-butyl N-(5-chloro-1H-pyrrolo[2,3-b]pyridin-6-yl)carbamate |
| InChIKey | MESCCEJMHUSKCH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C2C=CNC2=N1)Cl |
Computed by PubChem (NCBI)