CAS 221698-92-6 is the registry number for 4-Chloro-6,7-diethoxyquinazolin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-chloro-6,7-diethoxyquinazolin-2-amine (CAS 221698-92-6) is a chemical compound with the molecular formula C12H14ClN3O2 and a molecular weight of 267.71 g/mol. IUPAC name: 4-chloro-6,7-diethoxyquinazolin-2-amine. InChIKey: SYPOOWHMSTUFTR-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN3O2 |
|---|---|
| Molecular weight | 267.71 g/mol |
| IUPAC name | 4-chloro-6,7-diethoxyquinazolin-2-amine |
| InChIKey | SYPOOWHMSTUFTR-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C2C(=C1)C(=NC(=N2)N)Cl)OCC |
Computed by PubChem (NCBI)