CAS 1036273-10-5 appears in our catalog under these names: Methyl 2-hydroxy-2-(2,4,5-trifluorophenyl)acetate, 95%, Methyl 2-hydroxy-2-(2,4,5-trifluorophenyl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
Methyl 2-hydroxy-2-(2,4,5-trifluorophenyl)acetate (CAS 1036273-10-5) is a chemical compound with the molecular formula C9H7F3O3 and a molecular weight of 220.14 g/mol. IUPAC name: methyl 2-hydroxy-2-(2,4,5-trifluorophenyl)acetate. InChIKey: ZZIJVZDNCUJEOG-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O3 |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | methyl 2-hydroxy-2-(2,4,5-trifluorophenyl)acetate |
| InChIKey | ZZIJVZDNCUJEOG-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC(=C(C=C1F)F)F)O |
Computed by PubChem (NCBI)