CAS 103700-24-9 is the registry number for 3-Acetylamino-4-ethoxybenzenesulfonyl chloride, 98%. Offered by: Fluorochem. Available pack sizes: 1g.
3-acetamido-4-ethoxybenzenesulfonyl chloride (CAS 103700-24-9) is a chemical compound with the molecular formula C10H12ClNO4S and a molecular weight of 277.73 g/mol. IUPAC name: 3-acetamido-4-ethoxybenzenesulfonyl chloride. InChIKey: YJQJFRHCLLZDIL-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO4S |
|---|---|
| Molecular weight | 277.73 g/mol |
| IUPAC name | 3-acetamido-4-ethoxybenzenesulfonyl chloride |
| InChIKey | YJQJFRHCLLZDIL-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)S(=O)(=O)Cl)NC(=O)C |
Computed by PubChem (NCBI)