CAS 10372-90-4 appears in our catalog under these names: 2-Chloro-N,N-dimethyl-5-nitrobenzenesulfonamide, 95%, 2-Chloro-N,N-dimethyl-5-nitrobenzene-1-sulfonamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 25g, 0,5g.
2-chloro-N,N-dimethyl-5-nitrobenzenesulfonamide (CAS 10372-90-4) is a chemical compound with the molecular formula C8H9ClN2O4S and a molecular weight of 264.69 g/mol. IUPAC name: 2-chloro-N,N-dimethyl-5-nitrobenzenesulfonamide. InChIKey: OYTKZYRZJKFNSZ-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O4S |
|---|---|
| Molecular weight | 264.69 g/mol |
| IUPAC name | 2-chloro-N,N-dimethyl-5-nitrobenzenesulfonamide |
| InChIKey | OYTKZYRZJKFNSZ-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=C(C=CC(=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)