CAS 98490-76-7 appears in our catalog under these names: Ethyl 4-chloro-2-(methylsulfonyl)pyrimidine-5-carboxylate 97%, Ethyl 4-chloro-2-(methylsulfonyl)pyrimidine-5-carboxylate, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
Ethyl 4-chloro-2-methylsulfonylpyrimidine-5-carboxylate (CAS 98490-76-7) is a chemical compound with the molecular formula C8H9ClN2O4S and a molecular weight of 264.69 g/mol. IUPAC name: ethyl 4-chloro-2-methylsulfonylpyrimidine-5-carboxylate. InChIKey: AXYVXVXZUCFQGF-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O4S |
|---|---|
| Molecular weight | 264.69 g/mol |
| IUPAC name | ethyl 4-chloro-2-methylsulfonylpyrimidine-5-carboxylate |
| InChIKey | AXYVXVXZUCFQGF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(N=C1Cl)S(=O)(=O)C |
Computed by PubChem (NCBI)