CAS 3994-89-6 is the registry number for 4-Chloro-5-sulfamoylanthranilic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 100mg, 25mg, 5mg.
Methyl 2-amino-4-chloro-5-sulfamoylbenzoate (CAS 3994-89-6) is a chemical compound with the molecular formula C8H9ClN2O4S and a molecular weight of 264.69 g/mol. IUPAC name: methyl 2-amino-4-chloro-5-sulfamoylbenzoate. InChIKey: FQDAYGLXJHLEOA-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O4S |
|---|---|
| Molecular weight | 264.69 g/mol |
| IUPAC name | methyl 2-amino-4-chloro-5-sulfamoylbenzoate |
| InChIKey | FQDAYGLXJHLEOA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1N)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)