Products 929975-48-4
CAS 929975-48-4 is the registry number for 3-([(2-Chloropyridin-3-yl)sulfonyl]amino)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
3-[(2-chloro-3-pyridinyl)sulfonylamino]propanoic acid (CAS 929975-48-4) is a chemical compound with the molecular formula C8H9ClN2O4S and a molecular weight of 264.69 g/mol. IUPAC name: 3-[(2-chloro-3-pyridinyl)sulfonylamino]propanoic acid. InChIKey: XHCOLHODKBUAQD-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O4S |
|---|---|
| Molecular weight | 264.69 g/mol |
| IUPAC name | 3-[(2-chloro-3-pyridinyl)sulfonylamino]propanoic acid |
| InChIKey | XHCOLHODKBUAQD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)Cl)S(=O)(=O)NCCC(=O)O |
Computed by PubChem (NCBI)