CAS 1797564-61-4 is the registry number for 6-Nitro-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-nitro-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride (CAS 1797564-61-4) is a chemical compound with the molecular formula C8H9ClN2O4S and a molecular weight of 264.69 g/mol. IUPAC name: 6-nitro-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride. InChIKey: GBBNLSCCFUSIKW-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O4S |
|---|---|
| Molecular weight | 264.69 g/mol |
| IUPAC name | 6-nitro-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride |
| InChIKey | GBBNLSCCFUSIKW-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(S1(=O)=O)C=C(C=C2)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)