CAS 61694-98-2 appears in our catalog under these names: 5-Chloro-2-methoxy-4-methylaminobenzoic Acid, 5–Chloro–2–methoxy–4–(methylamino)benzoic acid, 5-Chloro-2-methoxy-4-(methylamino)benzoic acid, 95%, 5-Chloro-2-methoxy-4-(methylamino)benzoic acid 95%. Offered by: TRC, GLPBio, Combi-blocks, Ambeed. Available pack sizes: 10mg, 25mg, 5mg, 100mg, 250mg, 5g, 1g.
5-chloro-2-methoxy-4-(methylamino)benzoic acid (CAS 61694-98-2) is a chemical compound with the molecular formula C9H10ClNO3 and a molecular weight of 215.63 g/mol. IUPAC name: 5-chloro-2-methoxy-4-(methylamino)benzoic acid. InChIKey: TXJMYISJXPBNCC-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO3 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | 5-chloro-2-methoxy-4-(methylamino)benzoic acid |
| InChIKey | TXJMYISJXPBNCC-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C(=C1)OC)C(=O)O)Cl |
Computed by PubChem (NCBI)