CAS 103755-58-4 appears in our catalog under these names: (1–Phenyl–1H–1,2,3–triazol–4–yl)methanol, (1-Phenyl-1H-1,2,3-triazol-4-yl)methanol, (1-Phenyl-1h-1,2,3-triazol-4-yl)methanol, 98%, (1-Phenyl-1H-1,2,3-triazol-4-yl)methanol, ≥95%, ≥95%, (1-Phenyl-1H-1,2,3-triazol-4-yl)methanol, ≥95%,. Offered by: GLPBio, Biosynth, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g, 2,5g, 25g, 100g.
(1-phenyltriazol-4-yl)methanol (CAS 103755-58-4) is a chemical compound with the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. IUPAC name: (1-phenyltriazol-4-yl)methanol. InChIKey: UBFOXHGJGFQOFV-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | (1-phenyltriazol-4-yl)methanol |
| InChIKey | UBFOXHGJGFQOFV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(N=N2)CO |
Computed by PubChem (NCBI)