CAS 103824-10-8 is the registry number for (2Z)-2-(2,4-Dichlorophenyl)-3-(dimethylamino)prop-2-enal, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(Z)-2-(2,4-dichlorophenyl)-3-(dimethylamino)prop-2-enal (CAS 103824-10-8) is a chemical compound with the molecular formula C11H11Cl2NO and a molecular weight of 244.11 g/mol. IUPAC name: (Z)-2-(2,4-dichlorophenyl)-3-(dimethylamino)prop-2-enal. InChIKey: AMURNPAKOWBJIB-SOFGYWHQSA-N.
| Molecular formula | C11H11Cl2NO |
|---|---|
| Molecular weight | 244.11 g/mol |
| IUPAC name | (Z)-2-(2,4-dichlorophenyl)-3-(dimethylamino)prop-2-enal |
| InChIKey | AMURNPAKOWBJIB-SOFGYWHQSA-N |
| SMILES | CN(C)/C=C(\C=O)/C1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)