CAS 138716-24-2 is the registry number for (2E)-1-(3,4-Dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g.
(E)-1-(3,4-dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one (CAS 138716-24-2) is a chemical compound with the molecular formula C11H11Cl2NO and a molecular weight of 244.11 g/mol. IUPAC name: (E)-1-(3,4-dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one. InChIKey: ABRRTQJUYQGWLY-AATRIKPKSA-N.
| Molecular formula | C11H11Cl2NO |
|---|---|
| Molecular weight | 244.11 g/mol |
| IUPAC name | (E)-1-(3,4-dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one |
| InChIKey | ABRRTQJUYQGWLY-AATRIKPKSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)