Products 40950-96-7
CAS 40950-96-7 is the registry number for 3-(3,4-Dichlorophenyl)-N-ethylacrylamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-(3,4-dichlorophenyl)-N-ethylprop-2-enamide (CAS 40950-96-7) is a chemical compound with the molecular formula C11H11Cl2NO and a molecular weight of 244.11 g/mol. IUPAC name: (E)-3-(3,4-dichlorophenyl)-N-ethylprop-2-enamide. InChIKey: NJLUOVKNPNTSSS-GQCTYLIASA-N.
| Molecular formula | C11H11Cl2NO |
|---|---|
| Molecular weight | 244.11 g/mol |
| IUPAC name | (E)-3-(3,4-dichlorophenyl)-N-ethylprop-2-enamide |
| InChIKey | NJLUOVKNPNTSSS-GQCTYLIASA-N |
| SMILES | CCNC(=O)/C=C/C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)