CAS 137235-13-3 appears in our catalog under these names: 1-(2,4-Dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one, 98%, (2Z)-1-(2,4-dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
(E)-1-(2,4-dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one (CAS 137235-13-3) is a chemical compound with the molecular formula C11H11Cl2NO and a molecular weight of 244.11 g/mol. IUPAC name: (E)-1-(2,4-dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one. InChIKey: PCRNWHRXTOCARP-AATRIKPKSA-N.
| Molecular formula | C11H11Cl2NO |
|---|---|
| Molecular weight | 244.11 g/mol |
| IUPAC name | (E)-1-(2,4-dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one |
| InChIKey | PCRNWHRXTOCARP-AATRIKPKSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)