Products 1820716-76-4
CAS 1820716-76-4 is the registry number for 6,7-Dichloro-4,4-dimethyl-3,4-dihydroquinolin-2(1H)-one, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.
6,7-dichloro-4,4-dimethyl-1,3-dihydroquinolin-2-one (CAS 1820716-76-4) is a chemical compound with the molecular formula C11H11Cl2NO and a molecular weight of 244.11 g/mol. IUPAC name: 6,7-dichloro-4,4-dimethyl-1,3-dihydroquinolin-2-one. InChIKey: ZEGURSOXWQTJEO-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2NO |
|---|---|
| Molecular weight | 244.11 g/mol |
| IUPAC name | 6,7-dichloro-4,4-dimethyl-1,3-dihydroquinolin-2-one |
| InChIKey | ZEGURSOXWQTJEO-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)NC2=CC(=C(C=C21)Cl)Cl)C |
Computed by PubChem (NCBI)