CAS 1038291-14-3 appears in our catalog under these names: 3-[(2-Amino-1,3-thiazol-5-yl)methyl]benzoic acid, 95%, 3-((2-Amino-1,3-thiazol-5-yl)methyl)benzoic acid, 95%, 3-((2-Amino-1,3-thiazol-5-yl)methyl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
3-[(2-amino-1,3-thiazol-5-yl)methyl]benzoic acid (CAS 1038291-14-3) is a chemical compound with the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. IUPAC name: 3-[(2-amino-1,3-thiazol-5-yl)methyl]benzoic acid. InChIKey: GPZBWIDDZJBVSL-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2S |
|---|---|
| Molecular weight | 234.28 g/mol |
| IUPAC name | 3-[(2-amino-1,3-thiazol-5-yl)methyl]benzoic acid |
| InChIKey | GPZBWIDDZJBVSL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)CC2=CN=C(S2)N |
Computed by PubChem (NCBI)