CAS 57001-43-1 appears in our catalog under these names: 3-(1,3-Dioxo-2,3-dihydro-1h-isoindol-2-yl)propanethioamide, 95%, 3-(1,3-Dioxo-2,3-dihydro-1H-isoindol-2-yl)propanethioamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g.
3-(1,3-dioxoisoindol-2-yl)propanethioamide (CAS 57001-43-1) is a chemical compound with the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. IUPAC name: 3-(1,3-dioxoisoindol-2-yl)propanethioamide. InChIKey: DJQBXHATCJIPIV-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2S |
|---|---|
| Molecular weight | 234.28 g/mol |
| IUPAC name | 3-(1,3-dioxoisoindol-2-yl)propanethioamide |
| InChIKey | DJQBXHATCJIPIV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCC(=S)N |
Computed by PubChem (NCBI)