Products 885279-72-1

CAS 885279-72-1 is the registry number for 4-(3-Amino-phenyl)-thiazole-2-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10G, 1g.

Structural formula: {0} (CAS {1})

Methyl 4-(3-aminophenyl)-1,3-thiazole-2-carboxylate (CAS 885279-72-1) is a chemical compound with the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. IUPAC name: methyl 4-(3-aminophenyl)-1,3-thiazole-2-carboxylate. InChIKey: OAUXBAJKZQHHOH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10N2O2S
Molecular weight234.28 g/mol
IUPAC namemethyl 4-(3-aminophenyl)-1,3-thiazole-2-carboxylate
InChIKeyOAUXBAJKZQHHOH-UHFFFAOYSA-N
SMILESCOC(=O)C1=NC(=CS1)C2=CC(=CC=C2)N

Computed by PubChem (NCBI)