CAS 885279-72-1 is the registry number for 4-(3-Amino-phenyl)-thiazole-2-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10G, 1g.
Methyl 4-(3-aminophenyl)-1,3-thiazole-2-carboxylate (CAS 885279-72-1) is a chemical compound with the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. IUPAC name: methyl 4-(3-aminophenyl)-1,3-thiazole-2-carboxylate. InChIKey: OAUXBAJKZQHHOH-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2S |
|---|---|
| Molecular weight | 234.28 g/mol |
| IUPAC name | methyl 4-(3-aminophenyl)-1,3-thiazole-2-carboxylate |
| InChIKey | OAUXBAJKZQHHOH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC(=CS1)C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)