CAS 165682-79-1 appears in our catalog under these names: 2-(Benzylamino)-1,3-thiazole-4-carboxylic acid, 95%, 2-(Benzylamino)-1,3-thiazole-4-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 2000mg, 5000mg.
2-(benzylamino)-1,3-thiazole-4-carboxylic acid (CAS 165682-79-1) is a chemical compound with the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. IUPAC name: 2-(benzylamino)-1,3-thiazole-4-carboxylic acid. InChIKey: XKFYNYLHAGNTQF-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2S |
|---|---|
| Molecular weight | 234.28 g/mol |
| IUPAC name | 2-(benzylamino)-1,3-thiazole-4-carboxylic acid |
| InChIKey | XKFYNYLHAGNTQF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)