CAS 471911-16-7 is the registry number for 4-(4-Acetoxyphenyl)-2-aminothiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[4-(2-amino-1,3-thiazol-4-yl)phenyl] acetate (CAS 471911-16-7) is a chemical compound with the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. IUPAC name: [4-(2-amino-1,3-thiazol-4-yl)phenyl] acetate. InChIKey: PQXZUTQWKRTPBP-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2S |
|---|---|
| Molecular weight | 234.28 g/mol |
| IUPAC name | [4-(2-amino-1,3-thiazol-4-yl)phenyl] acetate |
| InChIKey | PQXZUTQWKRTPBP-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)C2=CSC(=N2)N |
Computed by PubChem (NCBI)