CAS 1038373-23-7 appears in our catalog under these names: 1-(2-(Pyridin-2-yl)ethyl)-1H-1,3-benzodiazol-2-amine, 95%, 1-(2-(Pyridin-2-yl)ethyl)-1H-1,3-benzodiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(2-pyridin-2-ylethyl)benzimidazol-2-amine (CAS 1038373-23-7) is a chemical compound with the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. IUPAC name: 1-(2-pyridin-2-ylethyl)benzimidazol-2-amine. InChIKey: ZEXYMKQDIPKRIA-UHFFFAOYSA-N.
| Molecular formula | C14H14N4 |
|---|---|
| Molecular weight | 238.29 g/mol |
| IUPAC name | 1-(2-pyridin-2-ylethyl)benzimidazol-2-amine |
| InChIKey | ZEXYMKQDIPKRIA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(N2CCC3=CC=CC=N3)N |
Computed by PubChem (NCBI)