CAS 103858-52-2 appears in our catalog under these names: Ethyl 4-bromo-1H-indole-2-carboxylate, 97%, 4-Bromo-1H-indole-2-carboxylic acid ethyl ester, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg.
Ethyl 4-bromo-1H-indole-2-carboxylate (CAS 103858-52-2) is a chemical compound with the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. IUPAC name: ethyl 4-bromo-1H-indole-2-carboxylate. InChIKey: KNPDUPLMXYEJAU-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO2 |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | ethyl 4-bromo-1H-indole-2-carboxylate |
| InChIKey | KNPDUPLMXYEJAU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C=CC=C2Br |
Computed by PubChem (NCBI)