CAS 103870-31-1 is the registry number for Di(quinolin-6-yl)methane, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(quinolin-6-ylmethyl)quinoline (CAS 103870-31-1) is a chemical compound with the molecular formula C19H14N2 and a molecular weight of 270.3 g/mol. IUPAC name: 6-(quinolin-6-ylmethyl)quinoline. InChIKey: QJHBOTXTQREYQP-UHFFFAOYSA-N.
| Molecular formula | C19H14N2 |
|---|---|
| Molecular weight | 270.3 g/mol |
| IUPAC name | 6-(quinolin-6-ylmethyl)quinoline |
| InChIKey | QJHBOTXTQREYQP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)CC3=CC4=C(C=C3)N=CC=C4)N=C1 |
Computed by PubChem (NCBI)