CAS 229020-91-1 is the registry number for 5-Methyl-6,12-dihydro-6,12-diazaindeno[1,2-b]fluorene, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
12-methyl-5,11-dihydroindolo[3,2-b]carbazole (CAS 229020-91-1) is a chemical compound with the molecular formula C19H14N2 and a molecular weight of 270.3 g/mol. IUPAC name: 12-methyl-5,11-dihydroindolo[3,2-b]carbazole. InChIKey: PSBPHGGTLVCYEF-UHFFFAOYSA-N.
| Molecular formula | C19H14N2 |
|---|---|
| Molecular weight | 270.3 g/mol |
| IUPAC name | 12-methyl-5,11-dihydroindolo[3,2-b]carbazole |
| InChIKey | PSBPHGGTLVCYEF-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC3=C1C4=CC=CC=C4N3)C5=CC=CC=C5N2 |
Computed by PubChem (NCBI)