Products 91025-04-6
CAS 91025-04-6 appears in our catalog under these names: 2-Phenyl-3-(pyridin-2-yl)-1H-indole 97%, 2-Phenyl-3-(2-pyridinyl)-1H-indole, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 25g, 100g, 500g.
2-phenyl-3-pyridin-2-yl-1H-indole (CAS 91025-04-6) is a chemical compound with the molecular formula C19H14N2 and a molecular weight of 270.3 g/mol. IUPAC name: 2-phenyl-3-pyridin-2-yl-1H-indole. InChIKey: OIKSDONQUJLCOE-UHFFFAOYSA-N.
| Molecular formula | C19H14N2 |
|---|---|
| Molecular weight | 270.3 g/mol |
| IUPAC name | 2-phenyl-3-pyridin-2-yl-1H-indole |
| InChIKey | OIKSDONQUJLCOE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C3=CC=CC=C3N2)C4=CC=CC=N4 |
Computed by PubChem (NCBI)