Products 155625-12-0
CAS 155625-12-0 is the registry number for 2-Phenyl-1-pyridin-2-yl-1H-indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
2-phenyl-1-pyridin-2-ylindole (CAS 155625-12-0) is a chemical compound with the molecular formula C19H14N2 and a molecular weight of 270.3 g/mol. IUPAC name: 2-phenyl-1-pyridin-2-ylindole. InChIKey: GNDVOWLVNORGSZ-UHFFFAOYSA-N.
| Molecular formula | C19H14N2 |
|---|---|
| Molecular weight | 270.3 g/mol |
| IUPAC name | 2-phenyl-1-pyridin-2-ylindole |
| InChIKey | GNDVOWLVNORGSZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=CC=CC=C3N2C4=CC=CC=N4 |
Computed by PubChem (NCBI)