CAS 103890-69-3 appears in our catalog under these names: Lacidipine Impurity 1, Lacidipine Impurity 4. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Tert-butyl (E)-3-(2-formylphenyl)prop-2-enoate (CAS 103890-69-3) is a chemical compound with the molecular formula C14H16O3 and a molecular weight of 232.27 g/mol. IUPAC name: tert-butyl (E)-3-(2-formylphenyl)prop-2-enoate. InChIKey: AXPDMCJJNSJNCA-CMDGGOBGSA-N.
| Molecular formula | C14H16O3 |
|---|---|
| Molecular weight | 232.27 g/mol |
| IUPAC name | tert-butyl (E)-3-(2-formylphenyl)prop-2-enoate |
| InChIKey | AXPDMCJJNSJNCA-CMDGGOBGSA-N |
| SMILES | CC(C)(C)OC(=O)/C=C/C1=CC=CC=C1C=O |
Computed by PubChem (NCBI)