Products 1038979-88-2
CAS 1038979-88-2 is the registry number for 8-Bromo-6-fluoro-1,2,3,4-tetrahydroquinoline, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g.
8-bromo-6-fluoro-1,2,3,4-tetrahydroquinoline (CAS 1038979-88-2) is a chemical compound with the molecular formula C9H9BrFN and a molecular weight of 230.08 g/mol. IUPAC name: 8-bromo-6-fluoro-1,2,3,4-tetrahydroquinoline. InChIKey: AUNNMCPVCZNEKB-UHFFFAOYSA-N.
| Molecular formula | C9H9BrFN |
|---|---|
| Molecular weight | 230.08 g/mol |
| IUPAC name | 8-bromo-6-fluoro-1,2,3,4-tetrahydroquinoline |
| InChIKey | AUNNMCPVCZNEKB-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=CC(=C2)F)Br)NC1 |
Computed by PubChem (NCBI)