CAS 1039338-62-9 appears in our catalog under these names: 4-Chloro-3-fluoro-dl-phenylglycine, 95%, 4-Chloro-3-fluoro-DL-phenylglycine, H-DL-Phg(3-F,4-Cl)-OH 97%. Offered by: Combi-blocks, Biosynth, Ambeed. Available pack sizes: 1g, 5g, 0,5g, 100mg, 250mg.
2-amino-2-(4-chloro-3-fluorophenyl)acetic acid (CAS 1039338-62-9) is a chemical compound with the molecular formula C8H7ClFNO2 and a molecular weight of 203.60 g/mol. IUPAC name: 2-amino-2-(4-chloro-3-fluorophenyl)acetic acid. InChIKey: BPNNVLOEKGJJJI-UHFFFAOYSA-N.
| Molecular formula | C8H7ClFNO2 |
|---|---|
| Molecular weight | 203.60 g/mol |
| IUPAC name | 2-amino-2-(4-chloro-3-fluorophenyl)acetic acid |
| InChIKey | BPNNVLOEKGJJJI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(C(=O)O)N)F)Cl |
Computed by PubChem (NCBI)