CAS 103967-49-3 is the registry number for benzylcysteine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2R)-2-amino-3-benzylsulfanylpropanoic acid;hydrochloride (CAS 103967-49-3) is a chemical compound with the molecular formula C10H14ClNO2S and a molecular weight of 247.74 g/mol. IUPAC name: (2R)-2-amino-3-benzylsulfanylpropanoic acid;hydrochloride. InChIKey: GPSDMSOGJZNLFX-FVGYRXGTSA-N.
| Molecular formula | C10H14ClNO2S |
|---|---|
| Molecular weight | 247.74 g/mol |
| IUPAC name | (2R)-2-amino-3-benzylsulfanylpropanoic acid;hydrochloride |
| InChIKey | GPSDMSOGJZNLFX-FVGYRXGTSA-N |
| SMILES | C1=CC=C(C=C1)CSC[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)