Products 827621-53-4
CAS 827621-53-4 is the registry number for 1-(2-Chlorophenyl)-N-isopropylmethanesulfonamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
1-(2-chlorophenyl)-N-propan-2-ylmethanesulfonamide (CAS 827621-53-4) is a chemical compound with the molecular formula C10H14ClNO2S and a molecular weight of 247.74 g/mol. IUPAC name: 1-(2-chlorophenyl)-N-propan-2-ylmethanesulfonamide. InChIKey: DTDZGQRSYUNONS-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2S |
|---|---|
| Molecular weight | 247.74 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-N-propan-2-ylmethanesulfonamide |
| InChIKey | DTDZGQRSYUNONS-UHFFFAOYSA-N |
| SMILES | CC(C)NS(=O)(=O)CC1=CC=CC=C1Cl |
Computed by PubChem (NCBI)