Products 1039815-76-3
CAS 1039815-76-3 appears in our catalog under these names: 2–Amino–6–chloro–3–fluorobenzoic acid, 2-Amino-6-chloro-3-fluorobenzoic acid, 2-Amino-6-chloro-3-fluorobenzoic acid, 95%, 2-Amino-6-chloro-3-fluorobenzoic acid, 95%, 95%. Offered by: GLPBio, Biosynth, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 2,5g, 250mg.
2-amino-6-chloro-3-fluorobenzoic acid (CAS 1039815-76-3) is a chemical compound with the molecular formula C7H5ClFNO2 and a molecular weight of 189.57 g/mol. IUPAC name: 2-amino-6-chloro-3-fluorobenzoic acid. InChIKey: WYADKQWQWFMCNJ-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFNO2 |
|---|---|
| Molecular weight | 189.57 g/mol |
| IUPAC name | 2-amino-6-chloro-3-fluorobenzoic acid |
| InChIKey | WYADKQWQWFMCNJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)N)C(=O)O)Cl |
Computed by PubChem (NCBI)